6-(3-methoxyphenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(3-methoxyphenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1884-40-8 | Molecular Weight | 236.26400 | |
| Density | 1.149g/cm3 | Boiling Point | 416.2ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | 6-(3-methoxyphenyl)-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 416.2ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 158.1ºC |
| Exact Mass | 236.10500 |
| PSA | 63.60000 |
| LogP | 2.52290 |
| Vapour Pressure | 1.13E-07mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | FIPMUXZDIZTVMD-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)CCCCC(=O)O)c1 |
| HS Code | 2918990090 |
|---|
|
~76%
6-(3-methoxyphe... CAS#:1884-40-8 |
| Literature: US2008/262011 A1, ; Page/Page column 18; 14 ; US 20080262011 A1 |
|
~%
6-(3-methoxyphe... CAS#:1884-40-8 |
| Literature: Tetrahedron, , vol. 29, p. 2183 - 2188 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(3-Methoxy-benzoyl)-pentansaeure |