3,5-dimethoxyphenylglyoxal hydrate structure
|
Common Name | 3,5-dimethoxyphenylglyoxal hydrate | ||
|---|---|---|---|---|
| CAS Number | 188199-78-2 | Molecular Weight | 212.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethoxyphenylglyoxal hydrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12O5 |
|---|---|
| Molecular Weight | 212.19900 |
| Exact Mass | 212.06800 |
| PSA | 75.99000 |
| LogP | 0.19720 |
| InChIKey | QNSGQYLIAUSUHQ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(=O)C=O)c1.O |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 1-azido-2,4-dimethoxyenzene |
| Benzene,1-azido-2,4-dimethoxy |
| 3,5-dimethoxyphenylglyoxal |
| 3,5-dimethoxyphenylazide |
| 3',5'-dimethoxyphenylglyoxal monohydrate |