sodium 4-(t-butylcarbonyloxy)-benzensulfonate
Modify Date: 2025-08-26 19:41:40
sodium 4-(t-butylcarbonyloxy)-benzensulfonate structure
|
Common Name | sodium 4-(t-butylcarbonyloxy)-benzensulfonate | ||
|---|---|---|---|---|
| CAS Number | 188114-91-2 | Molecular Weight | 280.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,4-(2,2-dimethylpropanoyloxy)benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NaO5S |
|---|---|
| Molecular Weight | 280.27300 |
| Exact Mass | 280.03800 |
| PSA | 91.88000 |
| LogP | 2.62300 |
| Appearance of Characters | Solid |
| InChIKey | YJWRXNUCTLGRAC-UHFFFAOYSA-M |
| SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| RB8012 |
| W4059 |
| p-Pivaloyloxybenzenesulfonic acid Sodium |
| 2,2-Dimethylpropanoic acid 4-sulfophenyl ester sodium salt |