[3-(1,1-dimethylethyl)phenoxy]acetic acid structure
|
Common Name | [3-(1,1-dimethylethyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1878-55-3 | Molecular Weight | 208.25400 | |
| Density | 1.088g/cm3 | Boiling Point | 320.3ºC at 760mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.4ºC | |
| Name | [3-(2-Methyl-2-propanyl)phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 320.3ºC at 760mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 118.4ºC |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.44750 |
| Vapour Pressure | 0.000133mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | TZCJVGQCSABBGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc(OCC(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4-dimethyl-1,2-pentadienylzinc chloride |