[6-(4-methoxyphenyl)pyridazin-3-yl]hydrazine
Modify Date: 2025-09-20 17:23:13
![[6-(4-methoxyphenyl)pyridazin-3-yl]hydrazine Structure](https://image.chemsrc.com/caspic/180/18772-76-4.png)
[6-(4-methoxyphenyl)pyridazin-3-yl]hydrazine structure
|
Common Name | [6-(4-methoxyphenyl)pyridazin-3-yl]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 18772-76-4 | Molecular Weight | 216.23900 | |
| Density | 1.258 g/cm3 | Boiling Point | 476.3ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.9ºC | |
| Name | [6-(4-methoxyphenyl)pyridazin-3-yl]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258 g/cm3 |
|---|---|
| Boiling Point | 476.3ºC at 760 mmHg |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.23900 |
| Flash Point | 241.9ºC |
| Exact Mass | 216.10100 |
| PSA | 73.06000 |
| LogP | 2.21110 |
| InChIKey | ASGDUFOXUMFAMV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(NN)nn2)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
[6-(4-methoxyph... CAS#:18772-76-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 2 p. 239 - 249 |
|
~%
[6-(4-methoxyph... CAS#:18772-76-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 2 p. 239 - 249 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:4776-87-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydrazinyl-6-(4-methoxyphenyl)pyridazine |
| 6-Hydrazino-3-(p-anisyl)pyridazin |
| 3-hydrazino-6-(p-methoxyphenyl)pyridazine |
| 3-hydrazino-6-(4-methoxyphenyl)pyridazine |
| 6-(4-methoxyphenyl)pyridazine-3-ylhydrazine |
| 3-(p-Anisyl)-6-hydrazinopyridazine |