Decanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl ester structure
|
Common Name | Decanoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl ester | ||
|---|---|---|---|---|
| CAS Number | 18770-65-5 | Molecular Weight | 586.35100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22F16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl decanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H22F16O2 |
|---|---|
| Molecular Weight | 586.35100 |
| Exact Mass | 586.13600 |
| PSA | 26.30000 |
| LogP | 8.38250 |
| InChIKey | RGPRDLSZLQYWMV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Decanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl ester |
| 1,1,9-Trihydroperfluorononyl decanoate |