5-allyl-2-phenoxyanisole structure
|
Common Name | 5-allyl-2-phenoxyanisole | ||
|---|---|---|---|---|
| CAS Number | 18738-93-7 | Molecular Weight | 240.29700 | |
| Density | 1.051g/cm3 | Boiling Point | 335.7ºC at 760mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.2ºC | |
| Name | 2-methoxy-1-phenoxy-4-prop-2-enylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 335.7ºC at 760mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 126.2ºC |
| Exact Mass | 240.11500 |
| PSA | 18.46000 |
| LogP | 4.21600 |
| Vapour Pressure | 0.000229mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | JXCFPQRFQYEEGF-UHFFFAOYSA-N |
| SMILES | C=CCc1ccc(Oc2ccccc2)c(OC)c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 242-548-5 |
| Eugenolphenylether |
| 5-Allyl-2-phenoxyanisole |
| Phenyleugenol |