Terephthalic acid dicyclopentyl ester structure
|
Common Name | Terephthalic acid dicyclopentyl ester | ||
|---|---|---|---|---|
| CAS Number | 18699-50-8 | Molecular Weight | 302.36500 | |
| Density | 1.18g/cm3 | Boiling Point | 424.6ºC at 760 mmHg | |
| Molecular Formula | C18H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | dicyclopentyl benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 424.6ºC at 760 mmHg |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.36500 |
| Flash Point | 210.4ºC |
| Exact Mass | 302.15200 |
| PSA | 52.60000 |
| LogP | 3.88540 |
| Vapour Pressure | 2.05E-07mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | GNGVJTMHQIYXRV-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCCC1)c1ccc(C(=O)OC2CCCC2)cc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Dicyclopentyl terephthalate |
| Terephthalic acid,dicyclopentyl ester |
| 1,4-Benzenedicarboxylic acid,dicyclopentyl ester |
| Terephthalsaeure-dicyclopentylester |