Bendamustine D-Mannitol Ester structure
|
Common Name | Bendamustine D-Mannitol Ester | ||
|---|---|---|---|---|
| CAS Number | 1869075-89-7 | Molecular Weight | 522.42 | |
| Density | 1.43±0.1 g/cm3 | Boiling Point | 808.8±65.0 °C | |
| Molecular Formula | C22H33Cl2N3O7 | Melting Point | 137-139°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Bendamustine D-Mannitol Ester |
|---|
| Density | 1.43±0.1 g/cm3 |
|---|---|
| Boiling Point | 808.8±65.0 °C |
| Melting Point | 137-139°C |
| Molecular Formula | C22H33Cl2N3O7 |
| Molecular Weight | 522.42 |
| Appearance of Characters | Solid,White to Off-White |
| InChIKey | SYGMXRXXVRHKHQ-MCEIDBOGSA-N |
| SMILES | Cn1c(CCCC(=O)OCC(O)C(O)C(O)C(O)CO)nc2cc(N(CCCl)CCCl)ccc21 |
| Storage condition | Hygroscopic, Refrigerator, under inert atmosphere |
| Water Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| HS Code | 2933998350 |
|---|