N-[(1-[1,1'-biphenyl]-4-yl-1-methylethoxy)carbonyl]-L-valine, compound with cyclohexylamine (1:1) structure
|
Common Name | N-[(1-[1,1'-biphenyl]-4-yl-1-methylethoxy)carbonyl]-L-valine, compound with cyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 18635-00-2 | Molecular Weight | 454.60200 | |
| Density | N/A | Boiling Point | 624ºC at 760 mmHg | |
| Molecular Formula | C27H38N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.2ºC | |
| Name | cyclohexanamine,(2S)-3-methyl-2-[2-(4-phenylphenyl)propan-2-yloxycarbonylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 624ºC at 760 mmHg |
|---|---|
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.60200 |
| Flash Point | 331.2ºC |
| Exact Mass | 454.28300 |
| PSA | 105.14000 |
| LogP | 6.60660 |
| Vapour Pressure | 1.96E-16mmHg at 25°C |
| InChIKey | QKSNECXABWULCS-FERBBOLQSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)c1ccc(-c2ccccc2)cc1)C(=O)O.NC1CCCCC1 |
| einecs 242-461-2 |