4-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)butanoic acid
Modify Date: 2025-08-20 03:06:23
4-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)butanoic acid structure
|
Common Name | 4-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 186320-14-9 | Molecular Weight | 401.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H23NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | Fmoc-4-(4-aminophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H23NO4 |
|---|---|
| Molecular Weight | 401.45400 |
| Exact Mass | 401.16300 |
| PSA | 75.63000 |
| LogP | 5.52790 |
| InChIKey | WDPZRHXDZBKJQJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| HS Code | 2922499990 |
|---|
|
~98%
4-(4-((((9H-Flu... CAS#:186320-14-9 |
| Literature: Myriad Pharmaceuticals, Inc. Patent: US2004/14763 A1, 2004 ; Location in patent: Page 23 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| fmoc-4-(4-aminophenyl)butanoic acid |