iCRT-5 structure
|
Common Name | iCRT-5 | ||
|---|---|---|---|---|
| CAS Number | 18623-44-4 | Molecular Weight | 367.44000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of iCRT-5iCRT-5 is a β-catenin-regulated transcription (CRT) inhibitor. iCRT-5 can block Wnt/β-catenin reporter activity and down regulate β-catenin expression. iCRT-5 can be used for the research of multiple myeloma[1][2]. |
| Name | iCRT5 |
|---|
| Description | iCRT-5 is a β-catenin-regulated transcription (CRT) inhibitor. iCRT-5 can block Wnt/β-catenin reporter activity and down regulate β-catenin expression. iCRT-5 can be used for the research of multiple myeloma[1][2]. |
|---|---|
| Related Catalog | |
| Target |
β-catenin-regulated transcription (CRT)[1] |
| References |
| Molecular Formula | C16H17NO5S2 |
|---|---|
| Molecular Weight | 367.44000 |
| Exact Mass | 367.05500 |
| PSA | 133.46000 |
| LogP | 2.70770 |
| InChIKey | IJWKSBPTJQMUHJ-LCYFTJDESA-N |
| SMILES | COc1ccc(C=C2SC(=S)N(CCCC(=O)O)C2=O)cc1OC |