2-O,3-O,4-O,5-O-Tetrakis(trimethylsilyl)-D-xylose structure
|
Common Name | 2-O,3-O,4-O,5-O-Tetrakis(trimethylsilyl)-D-xylose | ||
|---|---|---|---|---|
| CAS Number | 18623-22-8 | Molecular Weight | 438.85400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H42O5Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5-tetrakis(trimethylsilyloxy)pentanal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H42O5Si4 |
|---|---|
| Molecular Weight | 438.85400 |
| Exact Mass | 438.21100 |
| PSA | 53.99000 |
| LogP | 4.69710 |
| InChIKey | DWTGGLMCGFIELV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(C=O)O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,3,4,5-Tetra-O-trimethylsilylxylose |