N-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]propanediamide structure
|
Common Name | N-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]propanediamide | ||
|---|---|---|---|---|
| CAS Number | 18612-37-8 | Molecular Weight | 518.45900 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H25Cl2N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-[[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]propanediamide |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C24H25Cl2N5O2S |
| Molecular Weight | 518.45900 |
| Exact Mass | 517.11100 |
| PSA | 114.93000 |
| LogP | 5.34530 |
| Index of Refraction | 1.639 |
| InChIKey | UXIOOMWAZYWCFN-JFLMPSFJSA-N |
| SMILES | Cc1ccc(-c2csc(NC(=O)CC(=O)NN=Cc3ccc(N(CCCl)CCCl)cc3)n2)cc1 |
|
~%
N-[[4-[bis(2-ch... CAS#:18612-37-8 |
| Literature: Dhapalapur,M.G. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 154 - 156 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |