2-(4-bromobenzoyl)-1-benzofuran-5-carbaldehyde structure
|
Common Name | 2-(4-bromobenzoyl)-1-benzofuran-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 186093-87-8 | Molecular Weight | 329.14500 | |
| Density | 1.55g/cm3 | Boiling Point | 469.7ºC at 760mmHg | |
| Molecular Formula | C16H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | 2-(4-bromobenzoyl)-1-benzofuran-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760mmHg |
| Molecular Formula | C16H9BrO3 |
| Molecular Weight | 329.14500 |
| Flash Point | 237.9ºC |
| Exact Mass | 327.97400 |
| PSA | 47.28000 |
| LogP | 4.23880 |
| Vapour Pressure | 5.4E-09mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | CXNIVXNXALFJFS-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc2oc(C(=O)c3ccc(Br)cc3)cc2c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-chlorophenyl) thiomorpholine hydrochloride |