chloro-phenoxy-diphenylsilane structure
|
Common Name | chloro-phenoxy-diphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 18557-45-4 | Molecular Weight | 310.85000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15ClOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-phenoxy-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15ClOSi |
|---|---|
| Molecular Weight | 310.85000 |
| Exact Mass | 310.05800 |
| PSA | 9.23000 |
| LogP | 3.56080 |
| InChIKey | OALIDMOLXCWTQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)O[Si](C2=CC=CC=C2)(C3=CC=CC=C3)Cl |
|
~%
chloro-phenoxy-... CAS#:18557-45-4 |
| Literature: Gmelin Handbook: Si: MVol.C, 76, page 212 - 214 |
|
~%
chloro-phenoxy-... CAS#:18557-45-4 |
| Literature: Kipping Journal of the Chemical Society, 1927 , p. 2729,2731 |
|
~%
chloro-phenoxy-... CAS#:18557-45-4 |
| Literature: Kipping Journal of the Chemical Society, 1927 , p. 2729,2731 |
| Diphenyl-phenoxy-chlorsilan |
| Chlorphenoxydiphenylsilan |
| chloro-phenoxy-diphenyl-silane |
| Phenoxy-diphenyl-siliciumchlorid |
| Silane,chlorophenoxydiphenyl |