2-Hydrazino-5-nitrobenzoic acid structure
|
Common Name | 2-Hydrazino-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 185556-56-3 | Molecular Weight | 197.148 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 425.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8±27.3 °C | |
| Name | 2-hydrazinyl-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 425.0±40.0 °C at 760 mmHg |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.148 |
| Flash Point | 210.8±27.3 °C |
| Exact Mass | 197.043655 |
| PSA | 121.17000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | YOHRLDNFBRTUNQ-UHFFFAOYSA-N |
| SMILES | NNc1ccc([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2928000090 |
|---|
|
~83%
2-Hydrazino-5-n... CAS#:185556-56-3 |
| Literature: BRISTOL-MYERS SQUIBB COMPANY Patent: WO2008/79759 A1, 2008 ; Location in patent: Page/Page column 128-129 ; WO 2008/079759 A1 |
|
~%
2-Hydrazino-5-n... CAS#:185556-56-3 |
| Literature: Pfannstiel; Janecke Chemische Berichte, 1942 , vol. 75, p. 1096,1104 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Hydrazino-5-nitrobenzoic acid |
| 2-hydrazino-5-nitro-benzoic acid |
| Benzoic acid, 2-hydrazinyl-5-nitro- |
| I01-9261 |
| Benzoic acid,2-hydrazino-5-nitro |
| 2-Hydrazino-5-nitro-benzoesaeure |
| 5-nitro-2-hydrazinobenzoic acid |