Boc-5-hydroxy-DL-tryptophan
Modify Date: 2025-08-25 09:17:15
Boc-5-hydroxy-DL-tryptophan structure
|
Common Name | Boc-5-hydroxy-DL-tryptophan | ||
|---|---|---|---|---|
| CAS Number | 185525-63-7 | Molecular Weight | 320.340 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 590.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.8±30.1 °C | |
| Name | Boc-5-hydroxy-DL-tryptophan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.3±50.0 °C at 760 mmHg |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.340 |
| Flash Point | 310.8±30.1 °C |
| Exact Mass | 320.137207 |
| PSA | 111.65000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | JELADEDZLOFFTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccc(O)cc12)C(=O)O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-5-hydroxy- |
| 5-Hydroxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}tryptophan |