N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide
carbohydrazide Structure](https://image.chemsrc.com/caspic/139/185456-43-3.png)
N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide structure
|
Common Name | N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 185456-43-3 | Molecular Weight | 322.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26N2O4 |
|---|---|
| Molecular Weight | 322.39900 |
| Exact Mass | 322.18900 |
| PSA | 67.87000 |
| LogP | 4.25430 |
| InChIKey | BWBBWSRYKMISOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccccc1)C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1073-62-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-benzylhydrozoinodicarboxylic acid di-tert-butyl ester |
| di-tert-butyl 1-benzylhydrazine-1,2-dicarboxylate |
| DI-TERT-BUTYL 1-BENZYLHYDRAZINE-1,2-DICARBOXYLATE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: Related downstream products(CAS) of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide: 1073-62-7. |
| Q: What is the SMILES notation of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: SMILES notation of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is CC(C)(C)OC(=O)NN(Cc1ccccc1)C(=O)OC(C)(C)C. |
| Q: What is the LogP of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: LogP of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is 4.25430. |
| Q: What is the molecular weight of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: Molecular weight of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is 322.39900. |
| Q: What is the English name of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: The English name of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide. |
| Q: What is the CAS number of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: CAS number of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is 185456-43-3. |
| Q: What is the Chinese name of 185456-43-3? |
| A: Chinese name of 185456-43-3 is 185456-43-3. |
| Q: What English synonyms does N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide have? |
| A: English synonyms of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide: N-benzylhydrozoinodicarboxylic acid di-tert-butyl ester, di-tert-butyl 1-benzylhydrazine-1,2-dicarboxylate, DI-TERT-BUTYL 1-BENZYLHYDRAZINE-1,2-DICARBOXYLATE. |
| Q: What is the molecular formula of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: Molecular formula of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is C17H26N2O4. |
| Q: What is the InChIKey of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide? |
| A: InChIKey of N-benzyl-N’-[(tert-butoxy)carbonyl](tert-butoxy)carbohydrazide is BWBBWSRYKMISOZ-UHFFFAOYSA-N. |