Y02224
Modify Date: 2025-08-23 22:54:50
Y02224 structure
|
Common Name | Y02224 | ||
|---|---|---|---|---|
| CAS Number | 1853988-48-3 | Molecular Weight | 461.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17BrN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Y02224Y02224 is a BET inhibitor. It shows the reasonable antiproliferative effect on leukemia cells. |
| Name | Y02224 |
|---|
| Description | Y02224 is a BET inhibitor. It shows the reasonable antiproliferative effect on leukemia cells. |
|---|---|
| References | 1. Xue, X. Q.; Zhang, Y.; Liu, Z. X.; Song, M.; Xing, Y. L.; Xiang, Q. P.; Wang, Z.; Tu, Z. C.; Zhou, Y. L.; Ding, K.; Xu, Y. Discovery of benzo[cd]indol-2(1H)-ones as potent and specific BET bromodomain inhibitors: structure-based virtual screening, optimization |
| Molecular Formula | C20H17BrN2O4S |
|---|---|
| Molecular Weight | 461.33 |
| InChIKey | JTOXINSTQFVILZ-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)c2cccc3c(NS(=O)(=O)c4cc(Br)ccc4OC)ccc1c23 |