1,3-Bis((pentyloxy)carbothioyl)trisulfane
Modify Date: 2025-09-19 18:37:25
1,3-Bis((pentyloxy)carbothioyl)trisulfane structure
|
Common Name | 1,3-Bis((pentyloxy)carbothioyl)trisulfane | ||
|---|---|---|---|---|
| CAS Number | 1851-75-8 | Molecular Weight | 358.62700 | |
| Density | 1.231g/cm3 | Boiling Point | 424.8ºC at 760 mmHg | |
| Molecular Formula | C12H22O2S5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7ºC | |
| Name | O-pentyl (pentoxycarbothioyltrisulfanyl)methanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 424.8ºC at 760 mmHg |
| Molecular Formula | C12H22O2S5 |
| Molecular Weight | 358.62700 |
| Flash Point | 210.7ºC |
| Exact Mass | 358.02200 |
| PSA | 158.54000 |
| LogP | 5.99940 |
| Vapour Pressure | 4.99E-07mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | VZEDYVSFXDUDLE-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=S)SSSC(=S)OCCCCC |
|
~%
1,3-Bis((pentyl... CAS#:1851-75-8 |
| Literature: Bokarev,K.S. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1964 , p. 2074 - 2080 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1964 , p. 2175 - 2182 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Bis((pentyloxy)carbothioyl)trisulfane |
| Dipentylxanthogentrisulfid |