2-(bromomethyl)-4-methyl-6-nitrophenol structure
|
Common Name | 2-(bromomethyl)-4-methyl-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 185062-86-6 | Molecular Weight | 246.05800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(bromomethyl)-4-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8BrNO3 |
|---|---|
| Molecular Weight | 246.05800 |
| Exact Mass | 244.96900 |
| PSA | 66.05000 |
| LogP | 3.02690 |
| InChIKey | NXYAZWAFGRMUCJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(CBr)c(O)c([N+](=O)[O-])c1 |
|
~96%
2-(bromomethyl)... CAS#:185062-86-6 |
| Literature: Declercq, Jean-Paul; Delangle, Pascale; Dutasta, Jean-Pierre; Van Oostenryck, Luc; Simon, Pascal; Tinant, Bernard Journal of the Chemical Society. Perkin Transactions 2, 1996 , vol. 0, # 11 art. no. 6/019121, p. 2471 - 2478 |
| 6-bromomethyl-4-methyl-2-nitrophenol |