DTCBPy
Modify Date: 2025-10-21 09:15:45
DTCBPy structure
|
Common Name | DTCBPy | ||
|---|---|---|---|---|
| CAS Number | 1850369-76-4 | Molecular Weight | 738.013 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 780.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C52H55N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 425.6±32.9 °C | |
Use of DTCBPyDTCBPy is an efficient thermally activated delayed fluorescence (TADF) molecule. |
| Name | DTCBPy |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 780.0±60.0 °C at 760 mmHg |
| Molecular Formula | C52H55N3O |
| Molecular Weight | 738.013 |
| Flash Point | 425.6±32.9 °C |
| Exact Mass | 737.434509 |
| LogP | 16.60 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | WTKSSZXLHRLOAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c(C(=O)c2ccncc2)c1 |
| DTCBPy |
| {2,5-Bis[3,6-bis(2-methyl-2-propanyl)-9H-carbazol-9-yl]phenyl}(4-pyridinyl)methanone |
| Methanone, [2,5-bis[3,6-bis(1,1-dimethylethyl)-9H-carbazol-9-yl]phenyl]-4-pyridinyl- |