2-Methoxymethyl Montelukast 1,2-Diol(Mixture of Diastereomers)
Modify Date: 2025-08-25 17:35:19
2-Methoxymethyl Montelukast 1,2-Diol(Mixture of Diastereomers) structure
|
Common Name | 2-Methoxymethyl Montelukast 1,2-Diol(Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 184764-27-0 | Molecular Weight | 646.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H40ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methoxymethyl Montelukast 1,2-Diol |
|---|
| Molecular Formula | C37H40ClNO5S |
|---|---|
| Molecular Weight | 646.23500 |
| Exact Mass | 645.23200 |
| PSA | 114.18000 |
| LogP | 8.54860 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | GDWHPGYYQWDPST-VPDRCCDHSA-N |
| SMILES | COCOCC(C)(O)c1ccccc1CCC(SCC1(CC(=O)O)CC1)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
|
~%
2-Methoxymethyl... CAS#:184764-27-0 |
| Literature: Dufresne, Claude; Gallant, Michel; Gareau, Yves; Ruel, Rejean; Trimble, Laird; Labelle, Marc Journal of Organic Chemistry, 1996 , vol. 61, # 24 p. 8518 - 8525 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |