Decanedioic acid,1,10-bis(2-methylpropyl) ester
Modify Date: 2025-08-26 19:20:04
Decanedioic acid,1,10-bis(2-methylpropyl) ester structure
|
Common Name | Decanedioic acid,1,10-bis(2-methylpropyl) ester | ||
|---|---|---|---|---|
| CAS Number | 18420-46-7 | Molecular Weight | 314.46000 | |
| Density | 0.943g/cm3 | Boiling Point | 334.1ºC at 760mmHg | |
| Molecular Formula | C18H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.7ºC | |
| Name | bis(2-methylpropyl) decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.943g/cm3 |
|---|---|
| Boiling Point | 334.1ºC at 760mmHg |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.46000 |
| Flash Point | 146.7ºC |
| Exact Mass | 314.24600 |
| PSA | 52.60000 |
| LogP | 4.50560 |
| Vapour Pressure | 0.000131mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | HMOFGLGHQFZQDS-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)CCCCCCCCC(=O)OCC(C)C |
| HS Code | 2917131000 |
|---|
|
~%
Decanedioic aci... CAS#:18420-46-7 |
| Literature: Kay-Fries Chem. Inc. Patent: US2403804 , 1943 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917131000 |
|---|---|
| Summary | 2917131000 esters of adipic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Decandisaeure-diisobutylester |
| Diisobutyl-sebacat |
| Decanedioic acid,diisobutyl ester |
| diisobutyl sebacate |
| Sebacic acid,diisobutyl ester |