N,N-dimethyl-4-(triethoxysilyl)aniline structure
|
Common Name | N,N-dimethyl-4-(triethoxysilyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 18418-79-6 | Molecular Weight | 283.43900 | |
| Density | 1g/cm3 | Boiling Point | 312.2ºC at 760mmHg | |
| Molecular Formula | C14H25NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | N,N-dimethyl-4-triethoxysilylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 312.2ºC at 760mmHg |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.43900 |
| Flash Point | 142.6ºC |
| Exact Mass | 283.16000 |
| PSA | 30.93000 |
| LogP | 2.00800 |
| Vapour Pressure | 0.000536mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | ZDAMOIHILBVHMU-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(N(C)C)cc1 |
| HS Code | 2931900090 |
|---|
|
~81%
N,N-dimethyl-4-... CAS#:18418-79-6 |
| Literature: Murata, Miki; Suzuki, Katsuhiro; Watanabe, Shinji; Masuda, Yuzuru Journal of Organic Chemistry, 1997 , vol. 62, # 24 p. 8569 - 8571 |
|
~10%
N,N-dimethyl-4-... CAS#:18418-79-6 |
| Literature: Gmelin Handbook: Si: MVol.C, 77, page 215 - 216 |
|
~%
N,N-dimethyl-4-... CAS#:18418-79-6 |
| Literature: Gmelin Handbook: Si: MVol.C, 77, page 215 - 216 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethyl-4-triaethoxysilyl-anilin |
| N,N-Dimethyl-p-triethoxysilylaniline |
| p-Dimethylaminophenyltriethoxysilane |
| EINECS 242-296-6 |
| N,N-dimethyl-4-triethoxysilanyl-aniline |