Bis(trimethylsilyl) sebacate
Modify Date: 2025-08-25 21:11:30
Bis(trimethylsilyl) sebacate structure
|
Common Name | Bis(trimethylsilyl) sebacate | ||
|---|---|---|---|---|
| CAS Number | 18408-42-9 | Molecular Weight | 346.610 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 345.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C16H34O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.3±18.7 °C | |
| Name | 2,2-bis(trimethylsilyl)decanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.5±25.0 °C at 760 mmHg |
| Molecular Formula | C16H34O4Si2 |
| Molecular Weight | 346.610 |
| Flash Point | 135.3±18.7 °C |
| Exact Mass | 346.199554 |
| PSA | 52.60000 |
| LogP | 4.90 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.437 |
| InChIKey | BDACUOPQFMCPLO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)CCCCCCCCC(=O)O[Si](C)(C)C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
|
~%
Bis(trimethylsi... CAS#:18408-42-9 |
| Literature: Kotowska, Urszula; Isidorov, Valery A. Central European Journal of Chemistry, 2011 , vol. 9, # 5 p. 813 - 824 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| decanedioic acid bis-trimethylsilanyl ester |
| Decandisaeure-bis-trimethylsilylester |
| Bis(trimethylsilyl) sebacate |
| Decanedioic acid, bis(trimethylsilyl) ester |
| Di-trimethylsilylsebacat |
| Sebacic acid, bis(trimethylsilyl) ester |