(4-benzoyloxy-5-hydroxy-2-phenylmethoxy-oxan-3-yl) benzoate
Modify Date: 2025-09-26 09:31:30
(4-benzoyloxy-5-hydroxy-2-phenylmethoxy-oxan-3-yl) benzoate structure
|
Common Name | (4-benzoyloxy-5-hydroxy-2-phenylmethoxy-oxan-3-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 18403-13-9 | Molecular Weight | 448.46500 | |
| Density | 1.32g/cm3 | Boiling Point | 624.2ºC at 760 mmHg | |
| Molecular Formula | C26H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | (3-benzoyloxy-5-hydroxy-2-phenylmethoxyoxan-4-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 624.2ºC at 760 mmHg |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.46500 |
| Flash Point | 211.2ºC |
| Exact Mass | 448.15200 |
| PSA | 91.29000 |
| LogP | 3.37160 |
| Vapour Pressure | 1.93E-16mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | IFAACSJGKWZEDU-UHFFFAOYSA-N |
| SMILES | O=C(OC1C(O)COC(OCc2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| benzyl 2,3-di-O-benzoylpentopyranoside |
| (4-benzoyloxy-5-hydroxy-2-phenylmethoxy-oxan-3-yl) benzoate |