2,6-mansyl chloride structure
|
Common Name | 2,6-mansyl chloride | ||
|---|---|---|---|---|
| CAS Number | 18392-55-7 | Molecular Weight | 331.81700 | |
| Density | 1.355g/cm3 | Boiling Point | 502.5ºC at 760mmHg | |
| Molecular Formula | C17H14ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.7ºC | |
| Name | 6-(N-methylanilino)naphthalene-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 502.5ºC at 760mmHg |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.81700 |
| Flash Point | 257.7ºC |
| Exact Mass | 331.04300 |
| PSA | 45.76000 |
| LogP | 5.61600 |
| Vapour Pressure | 3.15E-10mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | AYRDPXRLSSGTRR-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1ccc2cc(S(=O)(=O)Cl)ccc2c1 |
|
~%
2,6-mansyl chloride CAS#:18392-55-7 |
| Literature: Kosower, Edward M.; Kanety, Hannah Journal of Molecular Structure, 1982 , vol. 84, p. 259 - 268 |
| Mansyl compounds |
| 2,6-Mansyl chloride |
| N-Methyl-2-anilino-6-naphthalin-sulfochlorid |
| N-Methyl-2-anilino-6-naphthalenesulfonyl chloride |