3-tert-butyl-7,11-dimethyldodeca-2,6,10-trien-1-ol structure
|
Common Name | 3-tert-butyl-7,11-dimethyldodeca-2,6,10-trien-1-ol | ||
|---|---|---|---|---|
| CAS Number | 183617-75-6 | Molecular Weight | 264.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-7,11-dimethyldodeca-2,6,10-trien-1-ol |
|---|
| Molecular Formula | C18H32O |
|---|---|
| Molecular Weight | 264.44600 |
| Exact Mass | 264.24500 |
| PSA | 20.23000 |
| LogP | 5.42410 |
| InChIKey | YVMFAYXJFDQHGA-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(=CCO)C(C)(C)C |
|
~%
3-tert-butyl-7,... CAS#:183617-75-6 |
| Literature: Zahn, Todd J.; Weinbaum, Carolyn; Gibbs, Richard A. Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 15 p. 1763 - 1766 |
|
~%
3-tert-butyl-7,... CAS#:183617-75-6 |
| Literature: Zahn, Todd J.; Weinbaum, Carolyn; Gibbs, Richard A. Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 15 p. 1763 - 1766 |