4,6-bis(phenylmethoxy)pyrimidine
Modify Date: 2025-08-28 09:46:26
4,6-bis(phenylmethoxy)pyrimidine structure
|
Common Name | 4,6-bis(phenylmethoxy)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 18337-66-1 | Molecular Weight | 292.33200 | |
| Density | 1.191g/cm3 | Boiling Point | 468.2ºC at 760mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 4,6-bis(phenylmethoxy)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 468.2ºC at 760mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.33200 |
| Flash Point | 167.4ºC |
| Exact Mass | 292.12100 |
| PSA | 44.24000 |
| LogP | 3.63460 |
| Vapour Pressure | 1.72E-08mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | WFHVBLJSKBEUKF-UHFFFAOYSA-N |
| SMILES | c1ccc(COc2cc(OCc3ccccc3)ncn2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dibenzyloxy-pyrimidin |