Benzenepropanoic acid, a-cyano-a-fluoro-, ethyl ester
Modify Date: 2025-08-25 11:23:44
Benzenepropanoic acid, a-cyano-a-fluoro-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a-cyano-a-fluoro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18283-28-8 | Molecular Weight | 221.22800 | |
| Density | 1.16g/cm3 | Boiling Point | 329.4ºC at 760 mmHg | |
| Molecular Formula | C12H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153ºC | |
| Name | ethyl 2-cyano-2-fluoro-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 329.4ºC at 760 mmHg |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.22800 |
| Flash Point | 153ºC |
| Exact Mass | 221.08500 |
| PSA | 50.09000 |
| LogP | 2.02408 |
| Vapour Pressure | 0.000178mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | PYAYGBFZBOXDIW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(C#N)Cc1ccccc1 |
|
~%
Benzenepropanoi... CAS#:18283-28-8 |
| Literature: Gershon,H. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 536 - 541 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:18283-40-4| Benzenepropanoic acid,a-cyano-a-fluoro-,ethyl ester |