α-Propylaminopentiophenone hydrochloride structure
|
Common Name | α-Propylaminopentiophenone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 18268-15-0 | Molecular Weight | 255.784 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of α-Propylaminopentiophenone hydrochlorideα-Propylaminopentiophenone is a substituted cathinone, intended for forensic and research applications. |
| Name | 1-Phenyl-2-(propylamino)-1-pentanone hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22ClNO |
|---|---|
| Molecular Weight | 255.784 |
| Exact Mass | 255.138992 |
| InChIKey | JAYJWNXAJKZWEM-UHFFFAOYSA-N |
| SMILES | CCCNC(CCC)C(=O)c1ccccc1.Cl |
| 1-Phenyl-2-(propylamino)-1-pentanone hydrochloride (1:1) |
| 1-Pentanone, 1-phenyl-2-(propylamino)-, hydrochloride (1:1) |