1-piperidin-4-yl-3-propylbenzimidazol-2-one structure
|
Common Name | 1-piperidin-4-yl-3-propylbenzimidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 182365-66-8 | Molecular Weight | 259.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-piperidin-4-yl-3-propylbenzimidazol-2-one |
|---|
| Molecular Formula | C15H21N3O |
|---|---|
| Molecular Weight | 259.34700 |
| Exact Mass | 259.16800 |
| PSA | 38.96000 |
| LogP | 2.46630 |
| InChIKey | ZZOGYJXOSHOSRM-UHFFFAOYSA-N |
| SMILES | CCCn1c(=O)n(C2CCNCC2)c2ccccc21 |
|
~%
1-piperidin-4-y... CAS#:182365-66-8 |
| Literature: Merck and Co., Inc. Patent: US6096763 A1, 2000 ; US 6096763 A Title/Abstract Full Text Show Details Merck and Co., Inc. Patent: US5952351 A1, 1999 ; US 5952351 A |