2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide
2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide structure
|
Common Name | 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide | ||
|---|---|---|---|---|
| CAS Number | 18232-70-7 | Molecular Weight | 229.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12ClNO3 |
|---|---|
| Molecular Weight | 229.66000 |
| Exact Mass | 229.05100 |
| PSA | 38.77000 |
| LogP | 1.73860 |
| InChIKey | BZMCWLGUXMFYNU-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)COc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
2-(4-chlorophen... CAS#:18232-70-7 |
| Literature: Beutner, Gregory L.; Kuethe, Jeffrey T.; Kim, Mary M.; Yasuda, Nobuyoshi Journal of Organic Chemistry, 2009 , vol. 74, # 2 p. 789 - 794 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: Polar surface area (PSA) of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is 38.77000. |
| Q: What is the CAS number of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: CAS number of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is 18232-70-7. |
| Q: What is the LogP of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: LogP of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is 1.73860. |
| Q: What is the SMILES notation of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: SMILES notation of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is CON(C)C(=O)COc1ccc(Cl)cc1. |
| Q: What is the English name of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: The English name of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide. |
| Q: What is the InChIKey of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: InChIKey of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is BZMCWLGUXMFYNU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 18232-70-7? |
| A: Chinese name of 18232-70-7 is 18232-70-7. |
| Q: What is the molecular weight of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: Molecular weight of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is 229.66000. |
| Q: What is the molecular formula of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide? |
| A: Molecular formula of 2-(4-chlorophenoxy)-N-methoxy-N-methylacetamide is C10H12ClNO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |