(2R)-3-amino-2-(benzenesulfonamido)propanoic acid
(2R)-3-amino-2-(benzenesulfonamido)propanoic acid structure
|
Common Name | (2R)-3-amino-2-(benzenesulfonamido)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 182301-14-0 | Molecular Weight | 244.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-3-amino-2-(benzenesulfonamido)propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12N2O4S |
|---|---|
| Molecular Weight | 244.26800 |
| Exact Mass | 244.05200 |
| PSA | 117.87000 |
| LogP | 1.54880 |
| InChIKey | QSCVWHIJUJGFDU-MRVPVSSYSA-N |
| SMILES | NCC(NS(=O)(=O)c1ccccc1)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: LogP of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is 1.54880. |
| Q: What is the polar surface area (PSA) of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: Polar surface area (PSA) of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is 117.87000. |
| Q: What is the molecular formula of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: Molecular formula of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is C9H12N2O4S. |
| Q: What is the molecular weight of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: Molecular weight of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is 244.26800. |
| Q: What is the CAS number of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: CAS number of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is 182301-14-0. |
| Q: What is the English name of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: The English name of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is (2R)-3-amino-2-(benzenesulfonamido)propanoic acid. |
| Q: What is the InChIKey of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: InChIKey of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is QSCVWHIJUJGFDU-MRVPVSSYSA-N. |
| Q: What is the SMILES notation of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid? |
| A: SMILES notation of (2R)-3-amino-2-(benzenesulfonamido)propanoic acid is NCC(NS(=O)(=O)c1ccccc1)C(=O)O. |