N-(1-adamantylmethylideneamino)-2,4-dinitro-aniline structure
|
Common Name | N-(1-adamantylmethylideneamino)-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 18220-81-0 | Molecular Weight | 344.36500 | |
| Density | 1.58g/cm3 | Boiling Point | 505ºC at 760 mmHg | |
| Molecular Formula | C17H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | N-(1-adamantylmethylideneamino)-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 505ºC at 760 mmHg |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.36500 |
| Flash Point | 259.2ºC |
| Exact Mass | 344.14800 |
| PSA | 116.03000 |
| LogP | 5.23650 |
| Vapour Pressure | 2.53E-10mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | VNXVTLSVTAEOLJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c1 |
|
~%
N-(1-adamantylm... CAS#:18220-81-0 |
| Literature: Applequist,D.E.; Kaplan,L. Journal of the American Chemical Society, 1965 , vol. 87, p. 2194 - 2200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Adamantan-1-carboxaldehyd-2,4-dinitrophenylhydrazon |
| 1-Adamantylaldehyd-2,4-dinitrophenylhydrazon |
| 1-Adamanthanecarbaldehyde 2,4-dinitrophenylhydrazone |