Amino-PEG9-Boc
Modify Date: 2025-11-25 19:03:06
Amino-PEG9-Boc structure
|
Common Name | Amino-PEG9-Boc | ||
|---|---|---|---|---|
| CAS Number | 1818294-44-8 | Molecular Weight | 541.672 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 576.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C25H51NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.9±25.0 °C | |
Use of Amino-PEG9-BocAmino-PEG9-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Amino-PEG9-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Amino-PEG9-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 576.2±45.0 °C at 760 mmHg |
| Molecular Formula | C25H51NO11 |
| Molecular Weight | 541.672 |
| Flash Point | 91.9±25.0 °C |
| Exact Mass | 541.346191 |
| LogP | -2.02 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | PPVFMACVSAAZFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| 2-Methyl-2-propanyl 1-amino-3,6,9,12,15,18,21,24,27-nonaoxatriacontan-30-oate |
| 3,6,9,12,15,18,21,24,27-Nonaoxatriacontan-30-oic acid, 1-amino-, 1,1-dimethylethyl ester |
| MFCD26127807 |