Fmoc-PEG6-NHS ester
Modify Date: 2025-12-01 12:17:44
Fmoc-PEG6-NHS ester structure
|
Common Name | Fmoc-PEG6-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1818294-31-3 | Molecular Weight | 672.719 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H44N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-PEG6-NHS esterFmoc-PEG6-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Fmoc-PEG6-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-PEG6-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C34H44N2O12 |
| Molecular Weight | 672.719 |
| Exact Mass | 672.289429 |
| LogP | 0.06 |
| Index of Refraction | 1.575 |
| InChIKey | KFJXLDJJJJQTGL-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| MFCD24539479 |
| 9H-Fluoren-9-ylmethyl {21-[(2,5-dioxo-1-pyrrolidinyl)oxy]-21-oxo-3,6,9,12,15,18-hexaoxahenicos-1-yl}carbamate |
| Carbamic acid, N-[21-[(2,5-dioxo-1-pyrrolidinyl)oxy]-21-oxo-3,6,9,12,15,18-hexaoxaheneicos-1-yl]-, 9H-fluoren-9-ylmethyl ester |