2-(4-Nitrophenoxy)pyrimidine structure
|
Common Name | 2-(4-Nitrophenoxy)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 181801-29-6 | Molecular Weight | 217.18100 | |
| Density | 1.371g/cm3 | Boiling Point | 411.7ºC at 760 mmHg | |
| Molecular Formula | C10H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | 2-(4-Nitrophenoxy)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 411.7ºC at 760 mmHg |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18100 |
| Flash Point | 202.8ºC |
| Exact Mass | 217.04900 |
| PSA | 80.83000 |
| LogP | 2.70030 |
| Vapour Pressure | 1.3E-06mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | VLNVCMOMPHXWLG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ncccn2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2804d22 |