1,4-Benzenedicarboxylic acid dihexyl ester
Modify Date: 2025-08-25 11:01:39
1,4-Benzenedicarboxylic acid dihexyl ester structure
|
Common Name | 1,4-Benzenedicarboxylic acid dihexyl ester | ||
|---|---|---|---|---|
| CAS Number | 1818-96-8 | Molecular Weight | 334.45000 | |
| Density | 1.012g/cm3 | Boiling Point | 383ºC at 760 mmHg | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Name | dihexyl benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 383ºC at 760 mmHg |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45000 |
| Flash Point | 203.4ºC |
| Exact Mass | 334.21400 |
| PSA | 52.60000 |
| LogP | 5.16080 |
| Vapour Pressure | 4.53E-06mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | MLIPQTRXLNTCRS-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)OCCCCCC)cc1 |
| HS Code | 2917399090 |
|---|
|
~87%
1,4-Benzenedica... CAS#:1818-96-8 |
| Literature: Lever Brothers Company, division of Conopco, Inc. Patent: US5078907 A1, 1992 ; |
|
~%
1,4-Benzenedica... CAS#:1818-96-8 |
| Literature: Arbusow; Waleewa Zhurnal Fizicheskoi Khimii, 1953 , vol. 27, p. 713,716 Chem.Abstr., 1954 , p. 13 |
|
~%
1,4-Benzenedica... CAS#:1818-96-8 |
| Literature: Dow Chem. Co. Patent: US2871256 , 1956 ; |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,4-benzenedicarboxylic acid,dihexyl ester |
| Terephthalsaeure-dihexylester |
| dihexyl terephthalate |
| terephthalic acid dihexyl ester |
| Di-n-hexylterephthalsaeure |