N-(2-chloroethyl)-N-nitrosopiperidine-1-sulfonamide
Modify Date: 2025-09-26 19:26:47
N-(2-chloroethyl)-N-nitrosopiperidine-1-sulfonamide structure
|
Common Name | N-(2-chloroethyl)-N-nitrosopiperidine-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 181762-10-7 | Molecular Weight | 255.72200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-chloroethyl)-N-nitrosopiperidine-1-sulfonamide |
|---|
| Molecular Formula | C7H14ClN3O3S |
|---|---|
| Molecular Weight | 255.72200 |
| Exact Mass | 255.04400 |
| PSA | 78.43000 |
| LogP | 1.95800 |
| InChIKey | VHMCRINZDBGPNR-UHFFFAOYSA-N |
| SMILES | O=NN(CCCl)S(=O)(=O)N1CCCCC1 |
|
~85%
N-(2-chloroethy... CAS#:181762-10-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 4, # 8 p. 1227 - 1235 |
|
~%
N-(2-chloroethy... CAS#:181762-10-7 |
| Literature: Abdaoui, Mohamed; Dewynter, Georges; Aouf, Nourredine; Favre, Gilles; Morere, Alain; Montero, Jean-Louis Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 8 p. 1227 - 1235 |
|
~%
N-(2-chloroethy... CAS#:181762-10-7 |
| Literature: Abdaoui, Mohamed; Dewynter, Georges; Montero, Jean-Louis Tetrahedron Letters, 1996 , vol. 37, # 32 p. 5695 - 5698 |
|
~%
N-(2-chloroethy... CAS#:181762-10-7 |
| Literature: Abdaoui, Mohamed; Dewynter, Georges; Montero, Jean-Louis Tetrahedron Letters, 1996 , vol. 37, # 32 p. 5695 - 5698 |
![2-[(Piperidine-1-sulfonyl)amino]ethan-1-ol structure](https://www.chemsrc.com/extcaspic/064/181762-02-7.png)
