potassium (Z)-hexadec-9-enoate
Modify Date: 2025-09-10 21:41:43
potassium (Z)-hexadec-9-enoate structure
|
Common Name | potassium (Z)-hexadec-9-enoate | ||
|---|---|---|---|---|
| CAS Number | 18175-44-5 | Molecular Weight | 292.49900 | |
| Density | N/A | Boiling Point | 363.6ºC at 760mmHg | |
| Molecular Formula | C16H29KO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | potassium,hexadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 363.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H29KO2 |
| Molecular Weight | 292.49900 |
| Flash Point | 239.2ºC |
| Exact Mass | 292.18000 |
| PSA | 40.13000 |
| LogP | 3.99360 |
| Vapour Pressure | 2.82E-06mmHg at 25°C |
| InChIKey | MHUCSRUPTZFQQD-CFYXSCKTSA-M |
| SMILES | CCCCCCC=CCCCCCCCC(=O)[O-].[K+] |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Palmitoleic acid,potassium salt |
| Potassiumpalmitoleate |
| potassium palmitolate |