3-[4-[3-[1-(2-cyanoethyl)piperidin-4-yl]propyl]piperidin-1-yl]propanenitrile
Modify Date: 2025-08-25 10:12:14
![3-[4-[3-[1-(2-cyanoethyl)piperidin-4-yl]propyl]piperidin-1-yl]propanenitrile Structure](https://image.chemsrc.com/caspic/131/18136-00-0.png)
3-[4-[3-[1-(2-cyanoethyl)piperidin-4-yl]propyl]piperidin-1-yl]propanenitrile structure
|
Common Name | 3-[4-[3-[1-(2-cyanoethyl)piperidin-4-yl]propyl]piperidin-1-yl]propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 18136-00-0 | Molecular Weight | 316.48400 | |
| Density | 0.988 g/cm3 | Boiling Point | 495.4ºC at 760 mmHg | |
| Molecular Formula | C19H32N4 | Melting Point | 71-73ºC | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 3-[4-[3-[1-(2-cyanoethyl)piperidin-4-yl]propyl]piperidin-1-yl]propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.988 g/cm3 |
|---|---|
| Boiling Point | 495.4ºC at 760 mmHg |
| Melting Point | 71-73ºC |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.48400 |
| Flash Point | 210.2ºC |
| Exact Mass | 316.26300 |
| PSA | 54.06000 |
| LogP | 3.28386 |
| Vapour Pressure | 5.94E-10mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | CUFGCSGPBRYOBH-UHFFFAOYSA-N |
| SMILES | N#CCCN1CCC(CCCC2CCN(CCC#N)CC2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 242-022-5 |