tris(diethylamino)-(2-hydroxyphenyl)phosphanium structure
|
Common Name | tris(diethylamino)-(2-hydroxyphenyl)phosphanium | ||
|---|---|---|---|---|
| CAS Number | 18110-22-0 | Molecular Weight | 375.91700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H35ClN3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(diethylamino)-(2-hydroxyphenyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H35ClN3OP |
|---|---|
| Molecular Weight | 375.91700 |
| Exact Mass | 375.22100 |
| PSA | 43.54000 |
| LogP | 0.80950 |
| InChIKey | SXGICKSXIDMKIV-UHFFFAOYSA-N |
| SMILES | CCN(CC)[P+](c1ccccc1O)(N(CC)CC)N(CC)CC.[Cl-] |
|
~%
tris(diethylami... CAS#:18110-22-0 |
| Literature: Denney,D.B.; Felton,S.M. Journal of the American Chemical Society, 1968 , vol. 90, p. 183 - 187 |
|
~%
tris(diethylami... CAS#:18110-22-0 |
| Literature: Denney,D.B.; Felton,S.M. Journal of the American Chemical Society, 1968 , vol. 90, p. 183 - 187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tris-(diaethylamino)-(o-hydroxy-phenyl)-phosphoniumchlorid |