1,2-Dimethyl tetramethoxydisilane structure
|
Common Name | 1,2-Dimethyl tetramethoxydisilane | ||
|---|---|---|---|---|
| CAS Number | 18107-32-9 | Molecular Weight | 210.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H18O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [dimethoxy(methyl)silyl]-dimethoxy-methylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H18O4Si2 |
|---|---|
| Molecular Weight | 210.37600 |
| Exact Mass | 210.07400 |
| PSA | 36.92000 |
| LogP | 0.79440 |
| InChIKey | BOXVSHDJQLZMFJ-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(OC)[Si](C)(OC)OC |
| HS Code | 2931900090 |
|---|
|
~%
1,2-Dimethyl te... CAS#:18107-32-9 |
| Literature: Maier, G.; Reisenauer, H. P.; Schoettler, K.; Wessolek-Kraus, U. Journal of Organometallic Chemistry, 1989 , vol. 366, p. 25 - 38 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-DIMETHYL TETRAMETHOXYDISILANE |
| 1,1,2,2-Tetramethoxydimethyldisilane |
| Disilane,1,1,2,2-tetramethoxy-1,2-dimethyl |
| 1,1,2,2-Tetramethoxy-1,2-dimethyldisilane |
| 1,2-Dimethyl-1,1,2,2-tetramethoxydisilane |