SMAP-2 structure
|
Common Name | SMAP-2 | ||
|---|---|---|---|---|
| CAS Number | 1809068-70-9 | Molecular Weight | 532.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27F3N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SMAP-2SMAP-2 (DT-1154) is an orally bioavailable phosphatase 2A (PP2A) activator which binds to the PP2A Aα scaffold subunit to drive conformational changes in PP2A. SMAP-2 (DT-1154) inhibits the growth of KRAS-mutant lung cancers [1]. |
| Name | SMAP-2 |
|---|
| Description | SMAP-2 (DT-1154) is an orally bioavailable phosphatase 2A (PP2A) activator which binds to the PP2A Aα scaffold subunit to drive conformational changes in PP2A. SMAP-2 (DT-1154) inhibits the growth of KRAS-mutant lung cancers [1]. |
|---|---|
| Related Catalog | |
| Target |
PP2A[1] |
| References |
| Molecular Formula | C27H27F3N2O4S |
|---|---|
| Molecular Weight | 532.57 |
| InChIKey | SDVKTCLBCCAFIS-HDYLNDSGSA-N |
| SMILES | O=S(=O)(NC1CCCC(N2c3ccccc3CCc3ccccc32)C1O)c1ccc(OC(F)(F)F)cc1 |