N-(1-cyclohex-2-enylideneamino)-4-methyl-benzenesulfonamide structure
|
Common Name | N-(1-cyclohex-2-enylideneamino)-4-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 18086-95-8 | Molecular Weight | 264.34300 | |
| Density | 1.23g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | N-(cyclohex-2-en-1-ylideneamino)-4-methylbenzenesulfonamide |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.34300 |
| Flash Point | 206.1ºC |
| Exact Mass | 264.09300 |
| PSA | 66.91000 |
| LogP | 3.84110 |
| Vapour Pressure | 3.59E-07mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | WLRAPHSXLCXIRB-OWBHPGMISA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2C=CCCC2)cc1 |
|
~71%
N-(1-cyclohex-2... CAS#:18086-95-8 |
| Literature: Ballini, Roberto; Giantomassi, Gianni Tetrahedron, 1995 , vol. 51, # 14 p. 4173 - 4182 |
|
~%
N-(1-cyclohex-2... CAS#:18086-95-8 |
| Literature: Meng, Xu; Li, Xiaolong; Chen, Wenlin; Zhang, Yuanqing; Wang, Wen; Chen, Jinying; Song, Jinli; Feng, Huijie; Chen, Baohua Journal of Heterocyclic Chemistry, 2014 , vol. 51, # 2 p. 349 - 356 |
|
~%
N-(1-cyclohex-2... CAS#:18086-95-8 |
| Literature: Ballini, Roberto; Bosica, Giovanna; Marcantoni, Enrico Tetrahedron, 1996 , vol. 52, # 32 p. 10705 - 10710 |