3,4-Dibromo-Mal-PEG2-N-Boc structure
|
Common Name | 3,4-Dibromo-Mal-PEG2-N-Boc | ||
|---|---|---|---|---|
| CAS Number | 1807537-43-4 | Molecular Weight | 486.153 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 513.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H22Br2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.1±30.1 °C | |
Use of 3,4-Dibromo-Mal-PEG2-N-Boc3,4-Dibromo-Mal-PEG2-N-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3,4-Dibromo-Mal-PEG2-Boc-Amine |
|---|---|
| Synonym | More Synonyms |
| Description | 3,4-Dibromo-Mal-PEG2-N-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.0±50.0 °C at 760 mmHg |
| Molecular Formula | C15H22Br2N2O6 |
| Molecular Weight | 486.153 |
| Flash Point | 264.1±30.1 °C |
| Exact Mass | 483.984436 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | XQHMCSGLWVRCQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN1C(=O)C(Br)=C(Br)C1=O |
| MFCD27635177 |
| Carbamic acid, N-[2-[2-[2-(3,4-dibromo-2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]ethoxy]ethyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (2-{2-[2-(3,4-dibromo-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy]ethoxy}ethyl)carbamate |