1-[2,4-Bis(benzyloxy)-6-hydroxyphenyl]ethanone structure
|
Common Name | 1-[2,4-Bis(benzyloxy)-6-hydroxyphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 18065-05-9 | Molecular Weight | 348.392 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 550.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5±22.2 °C | |
| Name | 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 550.4±45.0 °C at 760 mmHg |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.392 |
| Flash Point | 194.5±22.2 °C |
| Exact Mass | 348.136169 |
| PSA | 55.76000 |
| LogP | 5.68 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | HEHTYXOPJQUNOF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(O)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| AC-7933 |
| Ethanone, 1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]- |
| 2-hydroxy-4,6-dibenzyloxyacetophenone |
| SC1224 |
| 1-(2,4-Bis(benzyloxy)-6-hydroxyphenyl)ethanone |
| 1-[2,4-Bis(benzyloxy)-6-hydroxyphenyl]ethanone |